About prop-1-en-2-ylbenzene
prop-1-en-2-ylbenzene (PubChem CID 7407) has the molecular formula C9H10
and a molecular weight of 118.18 g/mol. Its IUPAC name is prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | prop-1-en-2-ylbenzene |
| PubChem CID | 7407 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1 |
| InChI | InChI=1S/C9H10/c1-8(2)9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
| InChIKey | XYLMUPLGERFSHI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylbenzene?
The IUPAC name of prop-1-en-2-ylbenzene (CID 7407) is prop-1-en-2-ylbenzene.
What is the SMILES notation for prop-1-en-2-ylbenzene?
The canonical SMILES for prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.
What is the InChIKey of prop-1-en-2-ylbenzene?
The InChIKey is XYLMUPLGERFSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10/c1-8(2)9-6-4-3-5-7-9/h3-7H,1H2,2H3.
What are the key properties of prop-1-en-2-ylbenzene?
prop-1-en-2-ylbenzene has a molecular weight of 118.18 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylbenzene is sourced from PubChem (CID 7407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).