C23H27FN4O3 — CID 7407157
4-[[(2S)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-N-phenylpiperidine-1-carboxamide (PubChem CID 7407157) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 4-[[(2S)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[[(2S)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 7407157 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[[(2S)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-N-phenylpiperidine-1-carboxamide |
| SMILES | CC(=O)N[C@@H](Cc1cccc(F)c1)C(=O)NC1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27FN4O3/c1-16(29)25-21(15-17-6-5-7-18(24)14-17)22(30)26-20-10-12-28(13-11-20)23(31)27-19-8-3-2-4-9-19/h2-9,14,20-21H,10-13,15H2,1H3,(H,25,29)(H,26,30)(H,27,31)/t21-/m0/s1 |
| InChIKey | ZELKDIAQANIUDA-NRFANRHFSA-N |
| XLogP | 2.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |