C17H22BrNO2 — CID 74071597
7-(bromomethyl)-N,N-diethyl-4-methylidene-6-oxotetracyclo[5.3.0.02,5.03,9]decane-8-carboxamide (PubChem CID 74071597) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 7-(bromomethyl)-N,N-diethyl-4-methylidene-6-oxotetracyclo[5.3.0.02,5.03,9]decane-8-carboxamide.
| Compound Name | 7-(bromomethyl)-N,N-diethyl-4-methylidene-6-oxotetracyclo[5.3.0.02,5.03,9]decane-8-carboxamide |
|---|---|
| PubChem CID | 74071597 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 7-(bromomethyl)-N,N-diethyl-4-methylidene-6-oxotetracyclo[5.3.0.02,5.03,9]decane-8-carboxamide |
| SMILES | C=C1C2C(=O)C3(CBr)C4CC(C1C24)C3C(=O)N(CC)CC |
| InChI | InChI=1S/C17H22BrNO2/c1-4-19(5-2)16(21)14-9-6-10-13-11(9)8(3)12(13)15(20)17(10,14)7-18/h9-14H,3-7H2,1-2H3 |
| InChIKey | RHSWLXDOOLZWPO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|