C23H24FN3O2 — CID 74075650
5-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydro-3H-[1,3,4]oxadiazolo[3,4-b]phthalazin-1-one (PubChem CID 74075650) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 5-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydro-3H-[1,3,4]oxadiazolo[3,4-b]phthalazin-1-one.
| Compound Name | 5-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydro-3H-[1,3,4]oxadiazolo[3,4-b]phthalazin-1-one |
|---|---|
| PubChem CID | 74075650 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 5-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydro-3H-[1,3,4]oxadiazolo[3,4-b]phthalazin-1-one |
| SMILES | O=C1OCN2C(C=Cc3ccc(-c4cccc(F)c4)cn3)C3CCCCC3CN12 |
| InChI | InChI=1S/C23H24FN3O2/c24-19-6-3-5-16(12-19)17-8-9-20(25-13-17)10-11-22-21-7-2-1-4-18(21)14-26-23(28)29-15-27(22)26/h3,5-6,8-13,18,21-22H,1-2,4,7,14-15H2 |
| InChIKey | KDAGDUAASVFJIY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |