C21H19N2O4- — CID 7407573
1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate (PubChem CID 7407573) has the molecular formula C21H19N2O4- and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate.
| Compound Name | 1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate |
|---|---|
| PubChem CID | 7407573 |
| Molecular Formula | C21H19N2O4- |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate |
| SMILES | Cc1ccc(/N=C/c2c([O-])c([N+](=O)[O-])cc3oc4c(c23)CCCC4)c(C)c1 |
| InChI | InChI=1S/C21H20N2O4/c1-12-7-8-16(13(2)9-12)22-11-15-20-14-5-3-4-6-18(14)27-19(20)10-17(21(15)24)23(25)26/h7-11,24H,3-6H2,1-2H3/p-1/b22-11+ |
| InChIKey | GCEZCCCPOWYXJH-SSDVNMTOSA-M |
| XLogP | 4.66 |
| TPSA | 91.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|