C25H22N2O6 — CID 74076239
4-(hydroxymethyl)-1-(1H-indol-3-yl)-7,7-dimethyl-3,6,8-trioxa-11-azapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-12,14,16-triene-10,18-dione (PubChem CID 74076239) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-(1H-indol-3-yl)-7,7-dimethyl-3,6,8-trioxa-11-azapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-12,14,16-triene-10,18-dione.
| Compound Name | 4-(hydroxymethyl)-1-(1H-indol-3-yl)-7,7-dimethyl-3,6,8-trioxa-11-azapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-12,14,16-triene-10,18-dione |
|---|---|
| PubChem CID | 74076239 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4-(hydroxymethyl)-1-(1H-indol-3-yl)-7,7-dimethyl-3,6,8-trioxa-11-azapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-12,14,16-triene-10,18-dione |
| SMILES | CC1(C)OC2C(CO)OC3C2(O1)C(=O)N1c2ccccc2C(=O)C31c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H22N2O6/c1-23(2)32-20-18(12-28)31-21-24(15-11-26-16-9-5-3-7-13(15)16)19(29)14-8-4-6-10-17(14)27(24)22(30)25(20,21)33-23/h3-11,18,20-21,26,28H,12H2,1-2H3 |
| InChIKey | KRWUDKFCELFAOW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |