C15H22N5O3- — CID 7407750
2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetate (PubChem CID 7407750) has the molecular formula C15H22N5O3- and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetate.
| Compound Name | 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 7407750 |
| Molecular Formula | C15H22N5O3- |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]oxy]acetate |
| SMILES | O=C([O-])COc1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H23N5O3/c21-12(22)11-23-15-17-13(19-7-3-1-4-8-19)16-14(18-15)20-9-5-2-6-10-20/h1-11H2,(H,21,22)/p-1 |
| InChIKey | RISUWRHELWVNTM-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |