About 2,3-diiodohex-2-ene
2,3-diiodohex-2-ene (PubChem CID 74078671) has the molecular formula C6H10I2
and a molecular weight of 335.95 g/mol. Its IUPAC name is 2,3-diiodohex-2-ene.
Molecular Properties
| Compound Name | 2,3-diiodohex-2-ene |
| PubChem CID | 74078671 |
| Molecular Formula | C6H10I2 |
| Molecular Weight | 335.95 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | 2,3-diiodohex-2-ene |
| SMILES | CCCC(I)=C(C)I |
| InChI | InChI=1S/C6H10I2/c1-3-4-6(8)5(2)7/h3-4H2,1-2H3 |
| InChIKey | SFABBPCEEBVWLH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiodohex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiodohex-2-ene?
The IUPAC name of 2,3-diiodohex-2-ene (CID 74078671) is 2,3-diiodohex-2-ene.
What is the SMILES notation for 2,3-diiodohex-2-ene?
The canonical SMILES for 2,3-diiodohex-2-ene is CCCC(I)=C(C)I.
What is the InChIKey of 2,3-diiodohex-2-ene?
The InChIKey is SFABBPCEEBVWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10I2/c1-3-4-6(8)5(2)7/h3-4H2,1-2H3.
What are the key properties of 2,3-diiodohex-2-ene?
2,3-diiodohex-2-ene has a molecular weight of 335.95 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiodohex-2-ene is sourced from PubChem (CID 74078671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).