2-(acetyloxymethyl)hexa-2,4-dienoic acid

C9H12O4 — CID 74079204

IUPAC2-(acetyloxymethyl)hexa-2,4-dienoic acid
SMILESCC=CC=C(COC(C)=O)C(=O)O
InChIInChI=1S/C9H12O4/c1-3-4-5-8(9(11)12)6-13-7(2)10/h3-5H,6H2,1-2H3,(H,11,12)
InChIKeyIIOKXVSQSQLJMO-UHFFFAOYSA-N
MW184.19 g/mol
LogP1.14
Rot. Bonds4

About 2-(acetyloxymethyl)hexa-2,4-dienoic acid

2-(acetyloxymethyl)hexa-2,4-dienoic acid (PubChem CID 74079204) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(acetyloxymethyl)hexa-2,4-dienoic acid.

Molecular Properties

Compound Name2-(acetyloxymethyl)hexa-2,4-dienoic acid
PubChem CID74079204
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name2-(acetyloxymethyl)hexa-2,4-dienoic acid
SMILESCC=CC=C(COC(C)=O)C(=O)O
InChIInChI=1S/C9H12O4/c1-3-4-5-8(9(11)12)6-13-7(2)10/h3-5H,6H2,1-2H3,(H,11,12)
InChIKeyIIOKXVSQSQLJMO-UHFFFAOYSA-N
XLogP1.14
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-(acetyloxymethyl)hexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(acetyloxymethyl)hexa-2,4-dienoic acid?
The IUPAC name of 2-(acetyloxymethyl)hexa-2,4-dienoic acid (CID 74079204) is 2-(acetyloxymethyl)hexa-2,4-dienoic acid.
What is the SMILES notation for 2-(acetyloxymethyl)hexa-2,4-dienoic acid?
The canonical SMILES for 2-(acetyloxymethyl)hexa-2,4-dienoic acid is CC=CC=C(COC(C)=O)C(=O)O.
What is the InChIKey of 2-(acetyloxymethyl)hexa-2,4-dienoic acid?
The InChIKey is IIOKXVSQSQLJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-3-4-5-8(9(11)12)6-13-7(2)10/h3-5H,6H2,1-2H3,(H,11,12).
What are the key properties of 2-(acetyloxymethyl)hexa-2,4-dienoic acid?
2-(acetyloxymethyl)hexa-2,4-dienoic acid has a molecular weight of 184.19 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(acetyloxymethyl)hexa-2,4-dienoic acid is sourced from PubChem (CID 74079204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).