C31H46O9 — CID 74079438
[4-methyl-2-[1,8,12-trihydroxy-3-(2-hydroxypropan-2-yl)-11-methoxy-6a,12b-dimethyl-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]hex-4-en-3-yl] acetate (PubChem CID 74079438) has the molecular formula C31H46O9 and a molecular weight of 562.70 g/mol. Its IUPAC name is [4-methyl-2-[1,8,12-trihydroxy-3-(2-hydroxypropan-2-yl)-11-methoxy-6a,12b-dimethyl-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]hex-4-en-3-yl] acetate.
| Compound Name | [4-methyl-2-[1,8,12-trihydroxy-3-(2-hydroxypropan-2-yl)-11-methoxy-6a,12b-dimethyl-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]hex-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 74079438 |
| Molecular Formula | C31H46O9 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | [4-methyl-2-[1,8,12-trihydroxy-3-(2-hydroxypropan-2-yl)-11-methoxy-6a,12b-dimethyl-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]hex-4-en-3-yl] acetate |
| SMILES | CC=C(C)C(OC(C)=O)C(C)c1cc(OC)c2c(c1O)OC1(C)CCC3OC(C(C)(C)O)CC(O)C3(C)C1C2O |
| InChI | InChI=1S/C31H46O9/c1-10-15(2)26(38-17(4)32)16(3)18-13-19(37-9)23-25(35)28-30(7,40-27(23)24(18)34)12-11-21-31(28,8)20(33)14-22(39-21)29(5,6)36/h10,13,16,20-22,25-26,28,33-36H,11-12,14H2,1-9H3 |
| InChIKey | XPMXROJYJMRHQN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|