C23H26FN3OS — CID 7408042
(2Z,5R)-5-butyl-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 7408042) has the molecular formula C23H26FN3OS and a molecular weight of 411.55 g/mol. Its IUPAC name is (2Z,5R)-5-butyl-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-5-butyl-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7408042 |
| Molecular Formula | C23H26FN3OS |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (2Z,5R)-5-butyl-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCC[C@H]1S/C(=N\N=C/c2ccc(C)cc2C)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C23H26FN3OS/c1-4-5-6-21-22(28)27(15-18-8-11-20(24)12-9-18)23(29-21)26-25-14-19-10-7-16(2)13-17(19)3/h7-14,21H,4-6,15H2,1-3H3/b25-14-,26-23-/t21-/m1/s1 |
| InChIKey | CBXLGGVASYWVNZ-BEWCOIKCSA-N |
| XLogP | 5.47 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|