C17H25Cl2N5O5S — CID 74081492
4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-ylpyrazolidine-3-carboxamide;methanesulfonic acid (PubChem CID 74081492) has the molecular formula C17H25Cl2N5O5S and a molecular weight of 482.39 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-ylpyrazolidine-3-carboxamide;methanesulfonic acid.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-ylpyrazolidine-3-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 74081492 |
| Molecular Formula | C17H25Cl2N5O5S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-ylpyrazolidine-3-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(NC1CNNC1C(=O)NC1CCNCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H21Cl2N5O2.CH4O3S/c17-10-2-1-3-11(18)13(10)15(24)22-12-8-20-23-14(12)16(25)21-9-4-6-19-7-5-9;1-5(2,3)4/h1-3,9,12,14,19-20,23H,4-8H2,(H,21,25)(H,22,24);1H3,(H,2,3,4) |
| InChIKey | GNSYMYIBCNMDSR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|