About (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide
(2S)-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 7408156) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide |
| PubChem CID | 7408156 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C=CCN1 |
| InChI | InChI=1S/C5H8N2O/c6-5(8)4-2-1-3-7-4/h1-2,4,7H,3H2,(H2,6,8)/t4-/m0/s1 |
| InChIKey | JMUVYFOYOQNXDU-BYPYZUCNSA-N |
| XLogP | -1.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide?
The IUPAC name of (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide (CID 7408156) is (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide.
What is the SMILES notation for (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide?
The canonical SMILES for (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide is NC(=O)[C@@H]1C=CCN1.
What is the InChIKey of (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide?
The InChIKey is JMUVYFOYOQNXDU-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H8N2O/c6-5(8)4-2-1-3-7-4/h1-2,4,7H,3H2,(H2,6,8)/t4-/m0/s1.
What are the key properties of (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide?
(2S)-2,5-dihydro-1H-pyrrole-2-carboxamide has a molecular weight of 112.13 g/mol, XLogP of -1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-dihydro-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 7408156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).