C10H17NaO4S — CID 74083975
sodium 1-hydroxy-3,7-dimethylocta-2,6-diene-1-sulfonate (PubChem CID 74083975) has the molecular formula C10H17NaO4S and a molecular weight of 256.30 g/mol. Its IUPAC name is sodium 1-hydroxy-3,7-dimethylocta-2,6-diene-1-sulfonate.
| Compound Name | sodium 1-hydroxy-3,7-dimethylocta-2,6-diene-1-sulfonate |
|---|---|
| PubChem CID | 74083975 |
| Molecular Formula | C10H17NaO4S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | sodium 1-hydroxy-3,7-dimethylocta-2,6-diene-1-sulfonate |
| SMILES | CC(C)=CCCC(C)=CC(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H18O4S.Na/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;/h5,7,10-11H,4,6H2,1-3H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | PAUXZHMWTKOCNI-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|