C7H10N2O4 — CID 7408483
3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 7408483) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 7408483 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@@H]1NC(=O)CNC1=O |
| InChI | InChI=1S/C7H10N2O4/c10-5-3-8-7(13)4(9-5)1-2-6(11)12/h4H,1-3H2,(H,8,13)(H,9,10)(H,11,12)/t4-/m0/s1 |
| InChIKey | WFLSPLQAZRBQJX-BYPYZUCNSA-N |
| XLogP | -1.53 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |