About N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide
N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide (PubChem CID 740890) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide |
| PubChem CID | 740890 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C16H15N3O/c1-11-9-12(2)18-16(15(11)10-17)19(13(3)20)14-7-5-4-6-8-14/h4-9H,1-3H3 |
| InChIKey | PKCPABFZDJFEQC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide?
The IUPAC name of N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide (CID 740890) is N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide.
What is the SMILES notation for N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide?
The canonical SMILES for N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide is CC(=O)N(c1ccccc1)c1nc(C)cc(C)c1C#N.
What is the InChIKey of N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide?
The InChIKey is PKCPABFZDJFEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-11-9-12(2)18-16(15(11)10-17)19(13(3)20)14-7-5-4-6-8-14/h4-9H,1-3H3.
What are the key properties of N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide?
N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide has a molecular weight of 265.32 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,6-dimethyl-2-pyridinyl)-N-phenylacetamide is sourced from PubChem (CID 740890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).