C20H22N4O3 — CID 7408947
prop-2-enyl (2S)-2-cyano-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]acetate (PubChem CID 7408947) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-cyano-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]acetate.
| Compound Name | prop-2-enyl (2S)-2-cyano-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 7408947 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | prop-2-enyl (2S)-2-cyano-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]acetate |
| SMILES | C=CCOC(=O)[C@H](C#N)c1nc2ccccc2nc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C20H22N4O3/c1-4-9-26-20(25)15(10-21)18-19(24-11-13(2)27-14(3)12-24)23-17-8-6-5-7-16(17)22-18/h4-8,13-15H,1,9,11-12H2,2-3H3/t13-,14+,15-/m1/s1 |
| InChIKey | DZRMNMRRCDRJOQ-QLFBSQMISA-N |
| XLogP | 2.58 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|