C40H63NO10 — CID 74089739
15-[5-(dimethylamino)-6-methyloxan-2-yl]oxy-19-ethyl-7-(3-hydroxy-4,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione (PubChem CID 74089739) has the molecular formula C40H63NO10 and a molecular weight of 717.94 g/mol. Its IUPAC name is 15-[5-(dimethylamino)-6-methyloxan-2-yl]oxy-19-ethyl-7-(3-hydroxy-4,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione.
| Compound Name | 15-[5-(dimethylamino)-6-methyloxan-2-yl]oxy-19-ethyl-7-(3-hydroxy-4,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
|---|---|
| PubChem CID | 74089739 |
| Molecular Formula | C40H63NO10 |
| Molecular Weight | 717.94 g/mol |
| Exact Mass | 717.45 |
| IUPAC Name | 15-[5-(dimethylamino)-6-methyloxan-2-yl]oxy-19-ethyl-7-(3-hydroxy-4,5-dimethoxy-6-methyloxan-2-yl)oxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
| SMILES | CCC1CCCC(OC2CCC(N(C)C)C(C)O2)C(C)C(=O)C2=CC3C(C=CC4CC(OC5OC(C)C(OC)C(OC)C5O)CC43)C2CC(=O)O1 |
| InChI | InChI=1S/C40H63NO10/c1-9-25-11-10-12-33(51-35-16-15-32(41(5)6)22(3)47-35)21(2)36(43)31-19-29-27(30(31)20-34(42)49-25)14-13-24-17-26(18-28(24)29)50-40-37(44)39(46-8)38(45-7)23(4)48-40/h13-14,19,21-30,32-33,35,37-40,44H,9-12,15-18,20H2,1-8H3 |
| InChIKey | IOCQRADVOJDJIS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|