About [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate
[(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate (PubChem CID 7409282) has the molecular formula C14H20Cl2N2O3S
and a molecular weight of 367.30 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
| PubChem CID | 7409282 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate |
| SMILES | CC(C)C[C@H](OC(=O)c1nsc(Cl)c1Cl)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H20Cl2N2O3S/c1-7(2)6-8(12(19)17-14(3,4)5)21-13(20)10-9(15)11(16)22-18-10/h7-8H,6H2,1-5H3,(H,17,19)/t8-/m0/s1 |
| InChIKey | MBEUTCPACXIJDU-QMMMGPOBSA-N |
| XLogP | 3.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate?
The IUPAC name of [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate (CID 7409282) is [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate.
What is the SMILES notation for [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate?
The canonical SMILES for [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate is CC(C)C[C@H](OC(=O)c1nsc(Cl)c1Cl)C(=O)NC(C)(C)C.
What is the InChIKey of [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate?
The InChIKey is MBEUTCPACXIJDU-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H20Cl2N2O3S/c1-7(2)6-8(12(19)17-14(3,4)5)21-13(20)10-9(15)11(16)22-18-10/h7-8H,6H2,1-5H3,(H,17,19)/t8-/m0/s1.
What are the key properties of [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate?
[(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate has a molecular weight of 367.30 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] 4,5-dichloro-1,2-thiazole-3-carboxylate is sourced from PubChem (CID 7409282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).