C19H26N2O6 — CID 7409794
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 7409794) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 7409794 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C1=COCCO1 |
| InChI | InChI=1S/C19H26N2O6/c1-3-25-16-12-15(21-5-7-23-8-6-21)17(26-4-2)11-14(16)20-19(22)18-13-24-9-10-27-18/h11-13H,3-10H2,1-2H3,(H,20,22) |
| InChIKey | PSMZMKRFRAVPNJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|