About N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide
N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 741072) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 741072 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c1-16-8-5-3-2-4-7(8)13-10(15)9-11-6-12-14-9/h2-6H,1H3,(H,13,15)(H,11,12,14) |
| InChIKey | WEOSNDYHFMTWJK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide (CID 741072) is N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide is COc1ccccc1NC(=O)c1ncn[nH]1.
What is the InChIKey of N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is WEOSNDYHFMTWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2/c1-16-8-5-3-2-4-7(8)13-10(15)9-11-6-12-14-9/h2-6H,1H3,(H,13,15)(H,11,12,14).
What are the key properties of N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide?
N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 218.22 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 741072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).