C11H12N4O — CID 741078
N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 741078) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 741078 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C11H12N4O/c1-7-3-4-8(2)9(5-7)14-11(16)10-12-6-13-15-10/h3-6H,1-2H3,(H,14,16)(H,12,13,15) |
| InChIKey | JXBBZJQHFGRSCZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |