C15H16F2O2 — CID 74111180
9,13-difluoro-12-methyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-en-10-one (PubChem CID 74111180) has the molecular formula C15H16F2O2 and a molecular weight of 266.29 g/mol. Its IUPAC name is 9,13-difluoro-12-methyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-en-10-one.
| Compound Name | 9,13-difluoro-12-methyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-en-10-one |
|---|---|
| PubChem CID | 74111180 |
| Molecular Formula | C15H16F2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 9,13-difluoro-12-methyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-en-10-one |
| SMILES | CC1OC(=O)C2(F)C3CC(C4C5C=CC(C5)C43)C12F |
| InChI | InChI=1S/C15H16F2O2/c1-6-14(16)9-5-10(15(14,17)13(18)19-6)12-8-3-2-7(4-8)11(9)12/h2-3,6-12H,4-5H2,1H3 |
| InChIKey | YPOOIGZHLIMMNN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|