C14H11BrN2O4 — CID 7411812
(3S)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 7411812) has the molecular formula C14H11BrN2O4 and a molecular weight of 351.16 g/mol. Its IUPAC name is (3S)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 7411812 |
| Molecular Formula | C14H11BrN2O4 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (3S)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Br)o1)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C14H11BrN2O4/c15-13-6-5-9(20-13)7-16-17-14(18)12-8-19-10-3-1-2-4-11(10)21-12/h1-7,12H,8H2,(H,17,18)/b16-7+/t12-/m0/s1 |
| InChIKey | JDXIZYHPMLDQPR-QFULYMJESA-N |
| XLogP | 2.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|