About (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione
(5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (PubChem CID 7412017) has the molecular formula C12H10ClN3O2
and a molecular weight of 263.68 g/mol. Its IUPAC name is (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
Molecular Properties
| Compound Name | (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| PubChem CID | 7412017 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| SMILES | O=C1C[C@]2(CCN=N2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN3O2/c13-8-1-3-9(4-2-8)16-10(17)7-12(11(16)18)5-6-14-15-12/h1-4H,5-7H2/t12-/m1/s1 |
| InChIKey | ZQKSSDSZUGULIW-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione?
The IUPAC name of (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (CID 7412017) is (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
What is the SMILES notation for (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione?
The canonical SMILES for (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione is O=C1C[C@]2(CCN=N2)C(=O)N1c1ccc(Cl)cc1.
What is the InChIKey of (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione?
The InChIKey is ZQKSSDSZUGULIW-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H10ClN3O2/c13-8-1-3-9(4-2-8)16-10(17)7-12(11(16)18)5-6-14-15-12/h1-4H,5-7H2/t12-/m1/s1.
What are the key properties of (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione?
(5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione has a molecular weight of 263.68 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-7-(4-chlorophenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione is sourced from PubChem (CID 7412017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).