C19H22FN6O2+ — CID 7412091
3-fluoro-N-[1-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidin-1-ium-4-yl]benzamide (PubChem CID 7412091) has the molecular formula C19H22FN6O2+ and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-fluoro-N-[1-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidin-1-ium-4-yl]benzamide.
| Compound Name | 3-fluoro-N-[1-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 7412091 |
| Molecular Formula | C19H22FN6O2+ |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-fluoro-N-[1-[[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidin-1-ium-4-yl]benzamide |
| SMILES | O=C(NC1CC[NH+](Cc2nnnn2Cc2ccco2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN6O2/c20-15-4-1-3-14(11-15)19(27)21-16-6-8-25(9-7-16)13-18-22-23-24-26(18)12-17-5-2-10-28-17/h1-5,10-11,16H,6-9,12-13H2,(H,21,27)/p+1 |
| InChIKey | SYFGSOMGCVOCOS-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |