C17H15N3O3S — CID 741247
methyl 4-[(5-amino-6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 741247) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl 4-[(5-amino-6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(5-amino-6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 741247 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | methyl 4-[(5-amino-6-methyl-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nc3cc(N)c(C)cc3s2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c1-9-7-14-13(8-12(9)18)19-17(24-14)20-15(21)10-3-5-11(6-4-10)16(22)23-2/h3-8H,18H2,1-2H3,(H,19,20,21) |
| InChIKey | GQNNRHHOBXJTIU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|