About propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate
propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7412520) has the molecular formula C13H18NO2S+
and a molecular weight of 252.36 g/mol. Its IUPAC name is propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate |
| PubChem CID | 7412520 |
| Molecular Formula | C13H18NO2S+ |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1CS[C@@H](c2ccccc2)[NH2+]1 |
| InChI | InChI=1S/C13H17NO2S/c1-9(2)16-13(15)11-8-17-12(14-11)10-6-4-3-5-7-10/h3-7,9,11-12,14H,8H2,1-2H3/p+1/t11-,12+/m1/s1 |
| InChIKey | AFYZORRWUBCUMW-NEPJUHHUSA-O |
| XLogP | 1.32 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate?
The IUPAC name of propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate (CID 7412520) is propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate.
What is the SMILES notation for propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate?
The canonical SMILES for propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate is CC(C)OC(=O)[C@H]1CS[C@@H](c2ccccc2)[NH2+]1.
What is the InChIKey of propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate?
The InChIKey is AFYZORRWUBCUMW-NEPJUHHUSA-O. The full InChI is InChI=1S/C13H17NO2S/c1-9(2)16-13(15)11-8-17-12(14-11)10-6-4-3-5-7-10/h3-7,9,11-12,14H,8H2,1-2H3/p+1/t11-,12+/m1/s1.
What are the key properties of propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate?
propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate has a molecular weight of 252.36 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S,4S)-2-phenyl-1,3-thiazolidin-3-ium-4-carboxylate is sourced from PubChem (CID 7412520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).