About 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine
3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 741327) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| PubChem CID | 741327 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | COc1ccc(CSc2nncn2N)cc1 |
| InChI | InChI=1S/C10H12N4OS/c1-15-9-4-2-8(3-5-9)6-16-10-13-12-7-14(10)11/h2-5,7H,6,11H2,1H3 |
| InChIKey | MBHZFCFGNZPXEK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine?
The IUPAC name of 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine (CID 741327) is 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine?
The canonical SMILES for 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine is COc1ccc(CSc2nncn2N)cc1.
What is the InChIKey of 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine?
The InChIKey is MBHZFCFGNZPXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-15-9-4-2-8(3-5-9)6-16-10-13-12-7-14(10)11/h2-5,7H,6,11H2,1H3.
What are the key properties of 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine?
3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine has a molecular weight of 236.30 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-4-amine is sourced from PubChem (CID 741327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).