C6H10N6OS — CID 7415780
(2R)-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide (PubChem CID 7415780) has the molecular formula C6H10N6OS and a molecular weight of 214.25 g/mol. Its IUPAC name is (2R)-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7415780 |
| Molecular Formula | C6H10N6OS |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2R)-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nc(N)nc(N)n1)C(N)=O |
| InChI | InChI=1S/C6H10N6OS/c1-2(3(7)13)14-6-11-4(8)10-5(9)12-6/h2H,1H3,(H2,7,13)(H4,8,9,10,11,12)/t2-/m1/s1 |
| InChIKey | YZBXJNWCZXXCJE-UWTATZPHSA-N |
| XLogP | -1.00 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |