C23H25N3O3S — CID 7417360
N-[4-[2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]hexanamide (PubChem CID 7417360) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[4-[2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7417360 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[4-[2-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CSc2nnc(-c3cccc(C)c3)o2)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-3-4-5-9-21(28)24-19-12-10-17(11-13-19)20(27)15-30-23-26-25-22(29-23)18-8-6-7-16(2)14-18/h6-8,10-14H,3-5,9,15H2,1-2H3,(H,24,28) |
| InChIKey | AJFAKIVIFWYWPT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|