C14H16O4 — CID 74188185
5-(3-cyclopenta-1,4-dien-1-ylprop-2-enyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 74188185) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-(3-cyclopenta-1,4-dien-1-ylprop-2-enyl)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(3-cyclopenta-1,4-dien-1-ylprop-2-enyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 74188185 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-(3-cyclopenta-1,4-dien-1-ylprop-2-enyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CC=CC2=CCC=C2)C(=O)O1 |
| InChI | InChI=1S/C14H16O4/c1-14(2)17-12(15)11(13(16)18-14)9-5-8-10-6-3-4-7-10/h3,5-8,11H,4,9H2,1-2H3 |
| InChIKey | ZOJLHRXWDDZPFH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|