About [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate
[4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate (PubChem CID 74191724) has the molecular formula C15H20O6
and a molecular weight of 296.32 g/mol. Its IUPAC name is [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate |
| PubChem CID | 74191724 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(C=CC(O)C(C)O)C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H20O6/c1-4-9(2)15(19)21-13(6-5-11(17)10(3)16)12-7-8-14(18)20-12/h4-8,10-13,16-17H,1-3H3 |
| InChIKey | ZABCZCJKVSSDHF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate?
The IUPAC name of [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate (CID 74191724) is [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate.
What is the SMILES notation for [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate?
The canonical SMILES for [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate is CC=C(C)C(=O)OC(C=CC(O)C(C)O)C1C=CC(=O)O1.
What is the InChIKey of [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate?
The InChIKey is ZABCZCJKVSSDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O6/c1-4-9(2)15(19)21-13(6-5-11(17)10(3)16)12-7-8-14(18)20-12/h4-8,10-13,16-17H,1-3H3.
What are the key properties of [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate?
[4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate has a molecular weight of 296.32 g/mol, XLogP of 0.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-dihydroxy-1-(5-oxo-2H-furan-2-yl)hex-2-enyl] 2-methylbut-2-enoate is sourced from PubChem (CID 74191724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).