C20H20FN3OS — CID 7420636
(2Z,5S)-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 7420636) has the molecular formula C20H20FN3OS and a molecular weight of 369.47 g/mol. Its IUPAC name is (2Z,5S)-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7420636 |
| Molecular Formula | C20H20FN3OS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2Z,5S)-2-[(Z)-(2,4-dimethylphenyl)methylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/C=N\N=C2/S[C@@H](C)C(=O)N2Cc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C20H20FN3OS/c1-13-4-7-17(14(2)10-13)11-22-23-20-24(19(25)15(3)26-20)12-16-5-8-18(21)9-6-16/h4-11,15H,12H2,1-3H3/b22-11-,23-20-/t15-/m0/s1 |
| InChIKey | XMKWKFDLZXGMOH-KNONYTRDSA-N |
| XLogP | 4.30 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|