C19H25N3O2S2 — CID 7421388
(2S)-N-cyclopentyl-2-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7421388) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7421388 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C[C@@H]1CCc2sc(-c3nnc(S[C@@H](C)C(=O)NC4CCCC4)o3)cc2C1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-11-7-8-15-13(9-11)10-16(26-15)18-21-22-19(24-18)25-12(2)17(23)20-14-5-3-4-6-14/h10-12,14H,3-9H2,1-2H3,(H,20,23)/t11-,12+/m1/s1 |
| InChIKey | MVDGENBKPXNVOH-NEPJUHHUSA-N |
| XLogP | 4.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |