About 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide
4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 742144) has the molecular formula C10H8N6O2S2
and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 742144 |
| Molecular Formula | C10H8N6O2S2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C10H8N6O2S2/c17-20(18,13-10-11-5-6-19-10)9-3-1-8(2-4-9)16-7-12-14-15-16/h1-7H,(H,11,13) |
| InChIKey | WJFMBGMKGIRMGN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (CID 742144) is 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide is O=S(=O)(Nc1nccs1)c1ccc(-n2cnnn2)cc1.
What is the InChIKey of 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is WJFMBGMKGIRMGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6O2S2/c17-20(18,13-10-11-5-6-19-10)9-3-1-8(2-4-9)16-7-12-14-15-16/h1-7H,(H,11,13).
What are the key properties of 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide?
4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 308.35 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tetrazol-1-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 742144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).