C16H22N2S2 — CID 74218144
1-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 74218144) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | 1-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 74218144 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | c1csc(CNC2CCCCC2NCc2cccs2)c1 |
| InChI | InChI=1S/C16H22N2S2/c1-2-8-16(18-12-14-6-4-10-20-14)15(7-1)17-11-13-5-3-9-19-13/h3-6,9-10,15-18H,1-2,7-8,11-12H2 |
| InChIKey | NUEHZAHSWVRWIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |