About 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 74220553) has the molecular formula C15H9Cl2N5O
and a molecular weight of 346.18 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 74220553 |
| Molecular Formula | C15H9Cl2N5O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2ccc(Cl)c(Cl)c2)nc2c(-c3ccn[nH]3)c[nH]n12 |
| InChI | InChI=1S/C15H9Cl2N5O/c16-10-2-1-8(5-11(10)17)13-6-14(23)22-15(20-13)9(7-19-22)12-3-4-18-21-12/h1-7,19H,(H,18,21) |
| InChIKey | CWDFDAZVDBXALK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 74220553) is 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(-c2ccc(Cl)c(Cl)c2)nc2c(-c3ccn[nH]3)c[nH]n12.
What is the InChIKey of 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is CWDFDAZVDBXALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2N5O/c16-10-2-1-8(5-11(10)17)13-6-14(23)22-15(20-13)9(7-19-22)12-3-4-18-21-12/h1-7,19H,(H,18,21).
What are the key properties of 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 346.18 g/mol, XLogP of 3.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-3-(1H-pyrazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 74220553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).