C29H27F4N3O — CID 74220591
(2R,5R,7R)-14-(4-fluorophenyl)-2-(pyridin-2-ylmethyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol (PubChem CID 74220591) has the molecular formula C29H27F4N3O and a molecular weight of 509.55 g/mol. Its IUPAC name is (2R,5R,7R)-14-(4-fluorophenyl)-2-(pyridin-2-ylmethyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol.
| Compound Name | (2R,5R,7R)-14-(4-fluorophenyl)-2-(pyridin-2-ylmethyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
|---|---|
| PubChem CID | 74220591 |
| Molecular Formula | C29H27F4N3O |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (2R,5R,7R)-14-(4-fluorophenyl)-2-(pyridin-2-ylmethyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
| SMILES | O[C@]1(C(F)(F)F)CC[C@]2(Cc3ccccn3)c3cc4cnn(-c5ccc(F)cc5)c4cc3CCC[C@@H]2C1 |
| InChI | InChI=1S/C29H27F4N3O/c30-22-7-9-24(10-8-22)36-26-15-19-4-3-5-21-16-28(37,29(31,32)33)12-11-27(21,17-23-6-1-2-13-34-23)25(19)14-20(26)18-35-36/h1-2,6-10,13-15,18,21,37H,3-5,11-12,16-17H2/t21-,27-,28-/m1/s1 |
| InChIKey | KKRGSWRLKSPSHX-KPGYKUMBSA-N |
| XLogP | 6.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |