C33H33N7O2 — CID 74220695
4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5,6-dimethylpyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 74220695) has the molecular formula C33H33N7O2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5,6-dimethylpyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5,6-dimethylpyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 74220695 |
| Molecular Formula | C33H33N7O2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5,6-dimethylpyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | Cc1nc(Nc2cccc(NC(=O)c3ccc(NC(=O)/C=C/CN(C)C)cc3)c2)nc(-c2c[nH]c3ccccc23)c1C |
| InChI | InChI=1S/C33H33N7O2/c1-21-22(2)35-33(39-31(21)28-20-34-29-12-6-5-11-27(28)29)38-26-10-7-9-25(19-26)37-32(42)23-14-16-24(17-15-23)36-30(41)13-8-18-40(3)4/h5-17,19-20,34H,18H2,1-4H3,(H,36,41)(H,37,42)(H,35,38,39)/b13-8+ |
| InChIKey | AFDUXWRPPMNYMV-MDWZMJQESA-N |
| XLogP | 6.29 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|