About (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol
(3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol (PubChem CID 74220813) has the molecular formula C27H20Cl3N3O
and a molecular weight of 508.84 g/mol. Its IUPAC name is (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol |
| PubChem CID | 74220813 |
| Molecular Formula | C27H20Cl3N3O |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol |
| SMILES | Cn1cc(C(O)(c2ccc(Cl)cc2)c2ccc3nc(Cl)c(Cc4ccccc4)c(Cl)c3c2)cn1 |
| InChI | InChI=1S/C27H20Cl3N3O/c1-33-16-20(15-31-33)27(34,18-7-10-21(28)11-8-18)19-9-12-24-22(14-19)25(29)23(26(30)32-24)13-17-5-3-2-4-6-17/h2-12,14-16,34H,13H2,1H3 |
| InChIKey | OOVDWIGQIZNEQZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol?
The IUPAC name of (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol (CID 74220813) is (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol.
What is the SMILES notation for (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol?
The canonical SMILES for (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol is Cn1cc(C(O)(c2ccc(Cl)cc2)c2ccc3nc(Cl)c(Cc4ccccc4)c(Cl)c3c2)cn1.
What is the InChIKey of (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol?
The InChIKey is OOVDWIGQIZNEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20Cl3N3O/c1-33-16-20(15-31-33)27(34,18-7-10-21(28)11-8-18)19-9-12-24-22(14-19)25(29)23(26(30)32-24)13-17-5-3-2-4-6-17/h2-12,14-16,34H,13H2,1H3.
What are the key properties of (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol?
(3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol has a molecular weight of 508.84 g/mol, XLogP of 6.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(1-methylpyrazol-4-yl)methanol is sourced from PubChem (CID 74220813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).