C29H44N4O4 — CID 74220830
(2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-[3-(5-methyl-1,3-dihydroisoindol-2-yl)pyrrolidin-1-yl]-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 74220830) has the molecular formula C29H44N4O4 and a molecular weight of 512.70 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-[3-(5-methyl-1,3-dihydroisoindol-2-yl)pyrrolidin-1-yl]-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-[3-(5-methyl-1,3-dihydroisoindol-2-yl)pyrrolidin-1-yl]-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 74220830 |
| Molecular Formula | C29H44N4O4 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-[3-(5-methyl-1,3-dihydroisoindol-2-yl)pyrrolidin-1-yl]-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | Cc1ccc2c(c1)CN(C1CCN(C(=O)[C@@H](NC(=O)C(CC3CCCC3)CN(O)C=O)C(C)(C)C)C1)C2 |
| InChI | InChI=1S/C29H44N4O4/c1-20-9-10-22-15-32(16-23(22)13-20)25-11-12-31(18-25)28(36)26(29(2,3)4)30-27(35)24(17-33(37)19-34)14-21-7-5-6-8-21/h9-10,13,19,21,24-26,37H,5-8,11-12,14-18H2,1-4H3,(H,30,35)/t24?,25?,26-/m1/s1 |
| InChIKey | KXASWTMDDHCGNB-NRUKRLKBSA-N |
| XLogP | 3.49 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|