C16H11FIN5O2S2 — CID 74220933
6-fluoro-1-[(2-iodophenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide (PubChem CID 74220933) has the molecular formula C16H11FIN5O2S2 and a molecular weight of 515.33 g/mol. Its IUPAC name is 6-fluoro-1-[(2-iodophenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide.
| Compound Name | 6-fluoro-1-[(2-iodophenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 74220933 |
| Molecular Formula | C16H11FIN5O2S2 |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | 6-fluoro-1-[(2-iodophenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc2cnn(Cc3ccccc3I)c2cc1F |
| InChI | InChI=1S/C16H11FIN5O2S2/c17-12-6-14-11(5-15(12)27(24,25)22-16-19-9-21-26-16)7-20-23(14)8-10-3-1-2-4-13(10)18/h1-7,9H,8H2,(H,19,21,22) |
| InChIKey | WDCFIOZXASZLCQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|