C25H27F4N3O3S — CID 74220988
[(2S,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-yl] sulfamate (PubChem CID 74220988) has the molecular formula C25H27F4N3O3S and a molecular weight of 525.57 g/mol. Its IUPAC name is [(2S,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-yl] sulfamate.
| Compound Name | [(2S,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-yl] sulfamate |
|---|---|
| PubChem CID | 74220988 |
| Molecular Formula | C25H27F4N3O3S |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [(2S,5S,7S)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-yl] sulfamate |
| SMILES | CC[C@]12CC[C@@](OS(N)(=O)=O)(C(F)(F)F)C[C@@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H27F4N3O3S/c1-2-23-10-11-24(25(27,28)29,35-36(30,33)34)14-18(23)5-3-4-16-13-22-17(12-21(16)23)15-31-32(22)20-8-6-19(26)7-9-20/h6-9,12-13,15,18H,2-5,10-11,14H2,1H3,(H2,30,33,34)/t18-,23-,24-/m0/s1 |
| InChIKey | AOWXGZATSAJDGW-NWVWQQAFSA-N |
| XLogP | 5.47 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |