C29H42F2N4O4 — CID 74221028
(2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[4-(4,7-difluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 74221028) has the molecular formula C29H42F2N4O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[4-(4,7-difluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[4-(4,7-difluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 74221028 |
| Molecular Formula | C29H42F2N4O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[4-(4,7-difluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC(N2Cc3c(F)ccc(F)c3C2)CC1 |
| InChI | InChI=1S/C29H42F2N4O4/c1-29(2,3)26(32-27(37)20(15-35(39)18-36)14-19-6-4-5-7-19)28(38)33-12-10-21(11-13-33)34-16-22-23(17-34)25(31)9-8-24(22)30/h8-9,18-21,26,39H,4-7,10-17H2,1-3H3,(H,32,37)/t20-,26-/m1/s1 |
| InChIKey | NVGLTCCCVLIKBP-FQRUVTKNSA-N |
| XLogP | 3.85 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|