C25H21ClN6O2S2 — CID 74221127
1-[[4-chloro-2-(1,2,3,4-tetrahydroisoquinolin-8-yl)phenyl]methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide (PubChem CID 74221127) has the molecular formula C25H21ClN6O2S2 and a molecular weight of 537.07 g/mol. Its IUPAC name is 1-[[4-chloro-2-(1,2,3,4-tetrahydroisoquinolin-8-yl)phenyl]methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide.
| Compound Name | 1-[[4-chloro-2-(1,2,3,4-tetrahydroisoquinolin-8-yl)phenyl]methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 74221127 |
| Molecular Formula | C25H21ClN6O2S2 |
| Molecular Weight | 537.07 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 1-[[4-chloro-2-(1,2,3,4-tetrahydroisoquinolin-8-yl)phenyl]methyl]-N-(1,2,4-thiadiazol-5-yl)indazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1ccc2c(cnn2Cc2ccc(Cl)cc2-c2cccc3c2CNCC3)c1 |
| InChI | InChI=1S/C25H21ClN6O2S2/c26-19-5-4-17(22(11-19)21-3-1-2-16-8-9-27-13-23(16)21)14-32-24-7-6-20(10-18(24)12-29-32)36(33,34)31-25-28-15-30-35-25/h1-7,10-12,15,27H,8-9,13-14H2,(H,28,30,31) |
| InChIKey | AKCGUMBUZCWBQJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.07 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |