C25H27FN2O — CID 74221171
(2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)spiro[14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-5,2'-oxirane] (PubChem CID 74221171) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)spiro[14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-5,2'-oxirane].
| Compound Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)spiro[14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-5,2'-oxirane] |
|---|---|
| PubChem CID | 74221171 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)spiro[14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraene-5,2'-oxirane] |
| SMILES | CC[C@@]12CC[C@@]3(CO3)C[C@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H27FN2O/c1-2-25-11-10-24(16-29-24)14-19(25)5-3-4-17-13-23-18(12-22(17)25)15-27-28(23)21-8-6-20(26)7-9-21/h6-9,12-13,15,19H,2-5,10-11,14,16H2,1H3/t19-,24+,25-/m1/s1 |
| InChIKey | ZKTSPQAEUXCTLG-BTZRARBUSA-N |
| XLogP | 5.72 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|