C26H31FN2O2 — CID 74221172
(2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-(methoxymethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol (PubChem CID 74221172) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-(methoxymethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol.
| Compound Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-(methoxymethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
|---|---|
| PubChem CID | 74221172 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (2R,5S,7R)-2-ethyl-14-(4-fluorophenyl)-5-(methoxymethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
| SMILES | CC[C@@]12CC[C@@](O)(COC)C[C@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C26H31FN2O2/c1-3-26-12-11-25(30,17-31-2)15-20(26)6-4-5-18-14-24-19(13-23(18)26)16-28-29(24)22-9-7-21(27)8-10-22/h7-10,13-14,16,20,30H,3-6,11-12,15,17H2,1-2H3/t20-,25+,26-/m1/s1 |
| InChIKey | WABAURUMMWQJRY-RFLWCCGPSA-N |
| XLogP | 5.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |