C27H20Cl3N3O — CID 74221196
(3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol (PubChem CID 74221196) has the molecular formula C27H20Cl3N3O and a molecular weight of 508.84 g/mol. Its IUPAC name is (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol.
| Compound Name | (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 74221196 |
| Molecular Formula | C27H20Cl3N3O |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | (3-benzyl-2,4-dichloroquinolin-6-yl)-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol |
| SMILES | Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(Cl)c(Cc3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C27H20Cl3N3O/c1-33-16-31-15-24(33)27(34,18-7-10-20(28)11-8-18)19-9-12-23-21(14-19)25(29)22(26(30)32-23)13-17-5-3-2-4-6-17/h2-12,14-16,34H,13H2,1H3 |
| InChIKey | IGBFRJGBHUMYIT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|