C29H21Cl3N2O2 — CID 74221260
(3-chlorophenyl)-[2,4-dichloro-3-[(4-methoxyphenyl)methyl]quinolin-6-yl]-pyridin-3-ylmethanol (PubChem CID 74221260) has the molecular formula C29H21Cl3N2O2 and a molecular weight of 535.86 g/mol. Its IUPAC name is (3-chlorophenyl)-[2,4-dichloro-3-[(4-methoxyphenyl)methyl]quinolin-6-yl]-pyridin-3-ylmethanol.
| Compound Name | (3-chlorophenyl)-[2,4-dichloro-3-[(4-methoxyphenyl)methyl]quinolin-6-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 74221260 |
| Molecular Formula | C29H21Cl3N2O2 |
| Molecular Weight | 535.86 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | (3-chlorophenyl)-[2,4-dichloro-3-[(4-methoxyphenyl)methyl]quinolin-6-yl]-pyridin-3-ylmethanol |
| SMILES | COc1ccc(Cc2c(Cl)nc3ccc(C(O)(c4cccnc4)c4cccc(Cl)c4)cc3c2Cl)cc1 |
| InChI | InChI=1S/C29H21Cl3N2O2/c1-36-23-10-7-18(8-11-23)14-25-27(31)24-16-20(9-12-26(24)34-28(25)32)29(35,21-5-3-13-33-17-21)19-4-2-6-22(30)15-19/h2-13,15-17,35H,14H2,1H3 |
| InChIKey | KGSQNIJWCOLAGX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.86 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|